C16H12O5S — CID 11493406
methyl (11S,15S)-8-hydroxy-13-oxo-16-oxa-12-thiatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate (PubChem CID 11493406) has the molecular formula C16H12O5S and a molecular weight of 316.33 g/mol. Its IUPAC name is methyl (11S,15S)-8-hydroxy-13-oxo-16-oxa-12-thiatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate.
| Compound Name | methyl (11S,15S)-8-hydroxy-13-oxo-16-oxa-12-thiatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate |
|---|---|
| PubChem CID | 11493406 |
| Molecular Formula | C16H12O5S |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl (11S,15S)-8-hydroxy-13-oxo-16-oxa-12-thiatetracyclo[8.6.0.02,7.011,15]hexadeca-1(10),2,4,6,8-pentaene-9-carboxylate |
| SMILES | COC(=O)c1c2c(c3ccccc3c1O)O[C@H]1CC(=O)S[C@@H]21 |
| InChI | InChI=1S/C16H12O5S/c1-20-16(19)11-12-14(21-9-6-10(17)22-15(9)12)8-5-3-2-4-7(8)13(11)18/h2-5,9,15,18H,6H2,1H3/t9-,15+/m0/s1 |
| InChIKey | PNQJNJNIKYQMRD-BJOHPYRUSA-N |
| XLogP | 2.80 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|