C11H14ClF2N — CID 114934206
4-chloro-N-[(2,6-difluorophenyl)methyl]butan-2-amine (PubChem CID 114934206) has the molecular formula C11H14ClF2N and a molecular weight of 233.69 g/mol. Its IUPAC name is 4-chloro-N-[(2,6-difluorophenyl)methyl]butan-2-amine.
| Compound Name | 4-chloro-N-[(2,6-difluorophenyl)methyl]butan-2-amine |
|---|---|
| PubChem CID | 114934206 |
| Molecular Formula | C11H14ClF2N |
| Molecular Weight | 233.69 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 4-chloro-N-[(2,6-difluorophenyl)methyl]butan-2-amine |
| SMILES | CC(CCCl)NCc1c(F)cccc1F |
| InChI | InChI=1S/C11H14ClF2N/c1-8(5-6-12)15-7-9-10(13)3-2-4-11(9)14/h2-4,8,15H,5-7H2,1H3 |
| InChIKey | MXLQVXJGCRIWJC-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|