About 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine
2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine (PubChem CID 114934448) has the molecular formula C17H25F2N
and a molecular weight of 281.39 g/mol. Its IUPAC name is 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine.
Molecular Properties
| Compound Name | 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine |
| PubChem CID | 114934448 |
| Molecular Formula | C17H25F2N |
| Molecular Weight | 281.39 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine |
| SMILES | CC1CCC(C(C)(C)Cc2c(F)cccc2F)C(N)C1 |
| InChI | InChI=1S/C17H25F2N/c1-11-7-8-13(16(20)9-11)17(2,3)10-12-14(18)5-4-6-15(12)19/h4-6,11,13,16H,7-10,20H2,1-3H3 |
| InChIKey | TXKCXJSTPOCCST-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine?
The IUPAC name of 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine (CID 114934448) is 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine.
What is the SMILES notation for 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine?
The canonical SMILES for 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine is CC1CCC(C(C)(C)Cc2c(F)cccc2F)C(N)C1.
What is the InChIKey of 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine?
The InChIKey is TXKCXJSTPOCCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2N/c1-11-7-8-13(16(20)9-11)17(2,3)10-12-14(18)5-4-6-15(12)19/h4-6,11,13,16H,7-10,20H2,1-3H3.
What are the key properties of 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine?
2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine has a molecular weight of 281.39 g/mol, XLogP of 4.30, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(2,6-difluorophenyl)-2-methylpropan-2-yl]-5-methylcyclohexan-1-amine is sourced from PubChem (CID 114934448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).