C15H13NO5S — CID 11493452
ethyl 2-(1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate (PubChem CID 11493452) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is ethyl 2-(1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate.
| Compound Name | ethyl 2-(1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate |
|---|---|
| PubChem CID | 11493452 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | ethyl 2-(1,3,3-trioxobenzo[e][1,2]benzothiazol-2-yl)acetate |
| SMILES | CCOC(=O)CN1C(=O)c2c(ccc3ccccc23)S1(=O)=O |
| InChI | InChI=1S/C15H13NO5S/c1-2-21-13(17)9-16-15(18)14-11-6-4-3-5-10(11)7-8-12(14)22(16,19)20/h3-8H,2,9H2,1H3 |
| InChIKey | GTYMDGXNYQHAMJ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |