C17H15Cl2NO — CID 11493465
3,3-dichloro-4-phenyl-8-oxa-2-azatricyclo[7.4.0.02,4]trideca-1(13),9,11-triene (PubChem CID 11493465) has the molecular formula C17H15Cl2NO and a molecular weight of 320.22 g/mol. Its IUPAC name is 3,3-dichloro-4-phenyl-8-oxa-2-azatricyclo[7.4.0.02,4]trideca-1(13),9,11-triene.
| Compound Name | 3,3-dichloro-4-phenyl-8-oxa-2-azatricyclo[7.4.0.02,4]trideca-1(13),9,11-triene |
|---|---|
| PubChem CID | 11493465 |
| Molecular Formula | C17H15Cl2NO |
| Molecular Weight | 320.22 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3,3-dichloro-4-phenyl-8-oxa-2-azatricyclo[7.4.0.02,4]trideca-1(13),9,11-triene |
| SMILES | ClC1(Cl)N2c3ccccc3OCCCC21c1ccccc1 |
| InChI | InChI=1S/C17H15Cl2NO/c18-17(19)16(13-7-2-1-3-8-13)11-6-12-21-15-10-5-4-9-14(15)20(16)17/h1-5,7-10H,6,11-12H2 |
| InChIKey | DLPZOONNVFVRCA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 12.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.22 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|