About [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine
[2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine (PubChem CID 114935146) has the molecular formula C13H17F2N
and a molecular weight of 225.28 g/mol. Its IUPAC name is [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine.
Molecular Properties
| Compound Name | [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine |
| PubChem CID | 114935146 |
| Molecular Formula | C13H17F2N |
| Molecular Weight | 225.28 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine |
| SMILES | NCC1CCCC1Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H17F2N/c14-12-5-2-6-13(15)11(12)7-9-3-1-4-10(9)8-16/h2,5-6,9-10H,1,3-4,7-8,16H2 |
| InChIKey | IZYRZPJMSQKEPQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine?
The IUPAC name of [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine (CID 114935146) is [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine.
What is the SMILES notation for [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine?
The canonical SMILES for [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine is NCC1CCCC1Cc1c(F)cccc1F.
What is the InChIKey of [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine?
The InChIKey is IZYRZPJMSQKEPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F2N/c14-12-5-2-6-13(15)11(12)7-9-3-1-4-10(9)8-16/h2,5-6,9-10H,1,3-4,7-8,16H2.
What are the key properties of [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine?
[2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine has a molecular weight of 225.28 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(2,6-difluorophenyl)methyl]cyclopentyl]methanamine is sourced from PubChem (CID 114935146), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).