C16H19F2NO — CID 114935331
1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(2,6-difluorophenyl)ethanone (PubChem CID 114935331) has the molecular formula C16H19F2NO and a molecular weight of 279.33 g/mol. Its IUPAC name is 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(2,6-difluorophenyl)ethanone.
| Compound Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(2,6-difluorophenyl)ethanone |
|---|---|
| PubChem CID | 114935331 |
| Molecular Formula | C16H19F2NO |
| Molecular Weight | 279.33 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 1-(2,3,3a,4,5,6,7,7a-octahydro-1H-indol-2-yl)-2-(2,6-difluorophenyl)ethanone |
| SMILES | O=C(Cc1c(F)cccc1F)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C16H19F2NO/c17-12-5-3-6-13(18)11(12)9-16(20)15-8-10-4-1-2-7-14(10)19-15/h3,5-6,10,14-15,19H,1-2,4,7-9H2 |
| InChIKey | PAZOHROOCPLDKP-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |