C17H14N2O2 — CID 114936055
1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-7-nitroindole (PubChem CID 114936055) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-7-nitroindole.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-7-nitroindole |
|---|---|
| PubChem CID | 114936055 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)-7-nitroindole |
| SMILES | O=[N+]([O-])c1cccc2ccn(CC3Cc4ccccc43)c12 |
| InChI | InChI=1S/C17H14N2O2/c20-19(21)16-7-3-5-12-8-9-18(17(12)16)11-14-10-13-4-1-2-6-15(13)14/h1-9,14H,10-11H2 |
| InChIKey | QCCJERRYLXUPQR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|