About 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine
2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine (PubChem CID 11493620) has the molecular formula C19H21FN2S
and a molecular weight of 328.46 g/mol. Its IUPAC name is 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine |
| PubChem CID | 11493620 |
| Molecular Formula | C19H21FN2S |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine |
| SMILES | C[C@@H](c1ccc(F)cn1)c1c(CCN(C)C)sc2ccccc12 |
| InChI | InChI=1S/C19H21FN2S/c1-13(16-9-8-14(20)12-21-16)19-15-6-4-5-7-17(15)23-18(19)10-11-22(2)3/h4-9,12-13H,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | ZQADELCMZHYIPT-ZDUSSCGKSA-N |
| XLogP | 4.69 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine?
The IUPAC name of 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine (CID 11493620) is 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine?
The canonical SMILES for 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine is C[C@@H](c1ccc(F)cn1)c1c(CCN(C)C)sc2ccccc12.
What is the InChIKey of 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine?
The InChIKey is ZQADELCMZHYIPT-ZDUSSCGKSA-N. The full InChI is InChI=1S/C19H21FN2S/c1-13(16-9-8-14(20)12-21-16)19-15-6-4-5-7-17(15)23-18(19)10-11-22(2)3/h4-9,12-13H,10-11H2,1-3H3/t13-/m0/s1.
What are the key properties of 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine?
2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine has a molecular weight of 328.46 g/mol, XLogP of 4.69, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-[(1R)-1-(5-fluoro-2-pyridinyl)ethyl]-1-benzothiophen-2-yl]-N,N-dimethylethanamine is sourced from PubChem (CID 11493620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).