C20H28O4 — CID 11493679
(4E,4aS,7S,10aR)-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-10-methylidene-1-oxo-4a,5,6,8,9,10a-hexahydrocycloocta[c]pyran-7-carbaldehyde (PubChem CID 11493679) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (4E,4aS,7S,10aR)-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-10-methylidene-1-oxo-4a,5,6,8,9,10a-hexahydrocycloocta[c]pyran-7-carbaldehyde.
| Compound Name | (4E,4aS,7S,10aR)-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-10-methylidene-1-oxo-4a,5,6,8,9,10a-hexahydrocycloocta[c]pyran-7-carbaldehyde |
|---|---|
| PubChem CID | 11493679 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (4E,4aS,7S,10aR)-4-[(E)-4-hydroxy-4-methylpent-2-enylidene]-7-methyl-10-methylidene-1-oxo-4a,5,6,8,9,10a-hexahydrocycloocta[c]pyran-7-carbaldehyde |
| SMILES | C=C1CC[C@@](C)(C=O)CC[C@@H]2/C(=C\C=C\C(C)(C)O)COC(=O)[C@@H]12 |
| InChI | InChI=1S/C20H28O4/c1-14-7-10-20(4,13-21)11-8-16-15(6-5-9-19(2,3)23)12-24-18(22)17(14)16/h5-6,9,13,16-17,23H,1,7-8,10-12H2,2-4H3/b9-5+,15-6-/t16-,17+,20-/m1/s1 |
| InChIKey | UDXXPMHZVKAWCF-IERAJXIUSA-N |
| XLogP | 3.36 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|