C20H28O4 — CID 11493680
(2R,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradec-1(13)-en-3-one (PubChem CID 11493680) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is (2R,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradec-1(13)-en-3-one.
| Compound Name | (2R,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradec-1(13)-en-3-one |
|---|---|
| PubChem CID | 11493680 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (2R,6E,7S,10S,11R)-11-hydroxy-6-[(E)-4-hydroxy-4-methylpent-2-enylidene]-10-methyl-4-oxatricyclo[8.3.1.02,7]tetradec-1(13)-en-3-one |
| SMILES | CC(C)(O)/C=C/C=C1/COC(=O)[C@H]2C3=CC[C@@H](O)[C@@](C)(CC[C@H]12)C3 |
| InChI | InChI=1S/C20H28O4/c1-19(2,23)9-4-5-14-12-24-18(22)17-13-6-7-16(21)20(3,11-13)10-8-15(14)17/h4-6,9,15-17,21,23H,7-8,10-12H2,1-3H3/b9-4+,14-5-/t15-,16-,17+,20+/m1/s1 |
| InChIKey | VDKKZKHDDPOYMA-CWVYIGCKSA-N |
| XLogP | 2.91 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|