C16H19N — CID 114939280
1-(1,2-dihydroacenaphthylen-5-yl)-N-methylpropan-1-amine (PubChem CID 114939280) has the molecular formula C16H19N and a molecular weight of 225.34 g/mol. Its IUPAC name is 1-(1,2-dihydroacenaphthylen-5-yl)-N-methylpropan-1-amine.
| Compound Name | 1-(1,2-dihydroacenaphthylen-5-yl)-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 114939280 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | 1-(1,2-dihydroacenaphthylen-5-yl)-N-methylpropan-1-amine |
| SMILES | CCC(NC)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C16H19N/c1-3-15(17-2)13-10-9-12-8-7-11-5-4-6-14(13)16(11)12/h4-6,9-10,15,17H,3,7-8H2,1-2H3 |
| InChIKey | UPSPMUAXLWBKSM-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |