About [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine
[4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine (PubChem CID 114939497) has the molecular formula C19H16ClN
and a molecular weight of 293.80 g/mol. Its IUPAC name is [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine.
Molecular Properties
| Compound Name | [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine |
| PubChem CID | 114939497 |
| Molecular Formula | C19H16ClN |
| Molecular Weight | 293.80 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine |
| SMILES | NCc1ccc(Cl)cc1-c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C19H16ClN/c20-15-8-6-14(11-21)18(10-15)16-9-7-13-5-4-12-2-1-3-17(16)19(12)13/h1-3,6-10H,4-5,11,21H2 |
| InChIKey | PLRNLJGEGWYQFY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.80 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine?
The IUPAC name of [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine (CID 114939497) is [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine.
What is the SMILES notation for [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine?
The canonical SMILES for [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine is NCc1ccc(Cl)cc1-c1ccc2c3c(cccc13)CC2.
What is the InChIKey of [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine?
The InChIKey is PLRNLJGEGWYQFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN/c20-15-8-6-14(11-21)18(10-15)16-9-7-13-5-4-12-2-1-3-17(16)19(12)13/h1-3,6-10H,4-5,11,21H2.
What are the key properties of [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine?
[4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine has a molecular weight of 293.80 g/mol, XLogP of 4.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-2-(1,2-dihydroacenaphthylen-5-yl)phenyl]methanamine is sourced from PubChem (CID 114939497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).