About 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan
3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan (PubChem CID 114939633) has the molecular formula C17H13ClO
and a molecular weight of 268.74 g/mol. Its IUPAC name is 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan.
Molecular Properties
| Compound Name | 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan |
| PubChem CID | 114939633 |
| Molecular Formula | C17H13ClO |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan |
| SMILES | ClC(c1ccoc1)c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C17H13ClO/c18-17(13-8-9-19-10-13)15-7-6-12-5-4-11-2-1-3-14(15)16(11)12/h1-3,6-10,17H,4-5H2 |
| InChIKey | RKUSQAFZMVAWPF-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan?
The IUPAC name of 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan (CID 114939633) is 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan.
What is the SMILES notation for 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan?
The canonical SMILES for 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan is ClC(c1ccoc1)c1ccc2c3c(cccc13)CC2.
What is the InChIKey of 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan?
The InChIKey is RKUSQAFZMVAWPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClO/c18-17(13-8-9-19-10-13)15-7-6-12-5-4-11-2-1-3-14(15)16(11)12/h1-3,6-10,17H,4-5H2.
What are the key properties of 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan?
3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan has a molecular weight of 268.74 g/mol, XLogP of 4.86, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[chloro(1,2-dihydroacenaphthylen-5-yl)methyl]furan is sourced from PubChem (CID 114939633), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).