C19H22O6 — CID 11493972
methyl (1R,2R,5R,8R,9S,10R,12R)-12-hydroxy-11-methylidene-6,13-dioxo-14-oxapentacyclo[10.2.2.15,8.01,10.02,8]heptadecane-9-carboxylate (PubChem CID 11493972) has the molecular formula C19H22O6 and a molecular weight of 346.38 g/mol. Its IUPAC name is methyl (1R,2R,5R,8R,9S,10R,12R)-12-hydroxy-11-methylidene-6,13-dioxo-14-oxapentacyclo[10.2.2.15,8.01,10.02,8]heptadecane-9-carboxylate.
| Compound Name | methyl (1R,2R,5R,8R,9S,10R,12R)-12-hydroxy-11-methylidene-6,13-dioxo-14-oxapentacyclo[10.2.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
|---|---|
| PubChem CID | 11493972 |
| Molecular Formula | C19H22O6 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.14 |
| IUPAC Name | methyl (1R,2R,5R,8R,9S,10R,12R)-12-hydroxy-11-methylidene-6,13-dioxo-14-oxapentacyclo[10.2.2.15,8.01,10.02,8]heptadecane-9-carboxylate |
| SMILES | C=C1[C@H]2[C@H](C(=O)OC)[C@]34CC(=O)[C@H](CC[C@H]3[C@]23CC[C@]1(O)C(=O)O3)C4 |
| InChI | InChI=1S/C19H22O6/c1-9-13-14(15(21)24-2)17-7-10(11(20)8-17)3-4-12(17)19(13)6-5-18(9,23)16(22)25-19/h10,12-14,23H,1,3-8H2,2H3/t10-,12-,13+,14-,17-,18-,19-/m1/s1 |
| InChIKey | QHSHJEKNAOLNNP-IJEHTGPNSA-N |
| XLogP | 1.16 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|