C18H21N — CID 114939791
N,3,3-trimethyltetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaen-5-amine (PubChem CID 114939791) has the molecular formula C18H21N and a molecular weight of 251.37 g/mol. Its IUPAC name is N,3,3-trimethyltetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaen-5-amine.
| Compound Name | N,3,3-trimethyltetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaen-5-amine |
|---|---|
| PubChem CID | 114939791 |
| Molecular Formula | C18H21N |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | N,3,3-trimethyltetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaen-5-amine |
| SMILES | CNC1CC(C)(C)c2c1cc1c3c(cccc23)CC1 |
| InChI | InChI=1S/C18H21N/c1-18(2)10-15(19-3)14-9-12-8-7-11-5-4-6-13(16(11)12)17(14)18/h4-6,9,15,19H,7-8,10H2,1-3H3 |
| InChIKey | FLQKHNJHXVESPQ-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |