C16H27NO2 — CID 114940978
2-ethoxy-N-[1-(2-methoxyphenyl)propyl]-2-methylpropan-1-amine (PubChem CID 114940978) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 2-ethoxy-N-[1-(2-methoxyphenyl)propyl]-2-methylpropan-1-amine.
| Compound Name | 2-ethoxy-N-[1-(2-methoxyphenyl)propyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 114940978 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 2-ethoxy-N-[1-(2-methoxyphenyl)propyl]-2-methylpropan-1-amine |
| SMILES | CCOC(C)(C)CNC(CC)c1ccccc1OC |
| InChI | InChI=1S/C16H27NO2/c1-6-14(17-12-16(3,4)19-7-2)13-10-8-9-11-15(13)18-5/h8-11,14,17H,6-7,12H2,1-5H3 |
| InChIKey | PKBLPOCDEJQZAK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |