C13H24F3NO — CID 114941480
N-(2-ethoxy-2-methylpropyl)-2-(trifluoromethyl)cyclohexan-1-amine (PubChem CID 114941480) has the molecular formula C13H24F3NO and a molecular weight of 267.33 g/mol. Its IUPAC name is N-(2-ethoxy-2-methylpropyl)-2-(trifluoromethyl)cyclohexan-1-amine.
| Compound Name | N-(2-ethoxy-2-methylpropyl)-2-(trifluoromethyl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 114941480 |
| Molecular Formula | C13H24F3NO |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | N-(2-ethoxy-2-methylpropyl)-2-(trifluoromethyl)cyclohexan-1-amine |
| SMILES | CCOC(C)(C)CNC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C13H24F3NO/c1-4-18-12(2,3)9-17-11-8-6-5-7-10(11)13(14,15)16/h10-11,17H,4-9H2,1-3H3 |
| InChIKey | BEWLVEUKTYTNMP-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |