C12H23N3O4S — CID 114945393
6-amino-N-[2-(methanesulfonamido)ethyl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptane-6-carboxamide (PubChem CID 114945393) has the molecular formula C12H23N3O4S and a molecular weight of 305.40 g/mol. Its IUPAC name is 6-amino-N-[2-(methanesulfonamido)ethyl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptane-6-carboxamide.
| Compound Name | 6-amino-N-[2-(methanesulfonamido)ethyl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptane-6-carboxamide |
|---|---|
| PubChem CID | 114945393 |
| Molecular Formula | C12H23N3O4S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 6-amino-N-[2-(methanesulfonamido)ethyl]-7,7-dimethyl-2-oxabicyclo[3.2.0]heptane-6-carboxamide |
| SMILES | CC1(C)C2OCCC2C1(N)C(=O)NCCNS(C)(=O)=O |
| InChI | InChI=1S/C12H23N3O4S/c1-11(2)9-8(4-7-19-9)12(11,13)10(16)14-5-6-15-20(3,17)18/h8-9,15H,4-7,13H2,1-3H3,(H,14,16) |
| InChIKey | DUBQWVXECNEFSL-UHFFFAOYSA-N |
| XLogP | -1.21 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|