C16H25N3O2 — CID 114945604
(6-amino-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone (PubChem CID 114945604) has the molecular formula C16H25N3O2 and a molecular weight of 291.39 g/mol. Its IUPAC name is (6-amino-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone.
| Compound Name | (6-amino-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 114945604 |
| Molecular Formula | C16H25N3O2 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.19 |
| IUPAC Name | (6-amino-7,7-dimethyl-2-oxabicyclo[3.2.0]heptan-6-yl)-(4-prop-2-ynylpiperazin-1-yl)methanone |
| SMILES | C#CCN1CCN(C(=O)C2(N)C3CCOC3C2(C)C)CC1 |
| InChI | InChI=1S/C16H25N3O2/c1-4-6-18-7-9-19(10-8-18)14(20)16(17)12-5-11-21-13(12)15(16,2)3/h1,12-13H,5-11,17H2,2-3H3 |
| InChIKey | HAFUTEVNHPDSPX-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|