About 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide
6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide (PubChem CID 114945852) has the molecular formula C17H30N2O2
and a molecular weight of 294.44 g/mol. Its IUPAC name is 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide.
Molecular Properties
| Compound Name | 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide |
| PubChem CID | 114945852 |
| Molecular Formula | C17H30N2O2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.23 |
| IUPAC Name | 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide |
| SMILES | CC1CCCCC1CNC(=O)C1(N)C2CCOC2C1(C)C |
| InChI | InChI=1S/C17H30N2O2/c1-11-6-4-5-7-12(11)10-19-15(20)17(18)13-8-9-21-14(13)16(17,2)3/h11-14H,4-10,18H2,1-3H3,(H,19,20) |
| InChIKey | QUMIBNXPCDOKBD-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
The IUPAC name of 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide (CID 114945852) is 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide.
What is the SMILES notation for 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
The canonical SMILES for 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide is CC1CCCCC1CNC(=O)C1(N)C2CCOC2C1(C)C.
What is the InChIKey of 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
The InChIKey is QUMIBNXPCDOKBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H30N2O2/c1-11-6-4-5-7-12(11)10-19-15(20)17(18)13-8-9-21-14(13)16(17,2)3/h11-14H,4-10,18H2,1-3H3,(H,19,20).
What are the key properties of 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide has a molecular weight of 294.44 g/mol, XLogP of 2.07, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7,7-dimethyl-N-[(2-methylcyclohexyl)methyl]-2-oxabicyclo[3.2.0]heptane-6-carboxamide is sourced from PubChem (CID 114945852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).