About 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide
6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide (PubChem CID 114945924) has the molecular formula C14H23N3O3
and a molecular weight of 281.36 g/mol. Its IUPAC name is 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide.
Molecular Properties
| Compound Name | 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide |
| PubChem CID | 114945924 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide |
| SMILES | CC1(C)C2OCCC2C1(N)C(=O)NC1CCCNC1=O |
| InChI | InChI=1S/C14H23N3O3/c1-13(2)10-8(5-7-20-10)14(13,15)12(19)17-9-4-3-6-16-11(9)18/h8-10H,3-7,15H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | VTRWKSVPMTXTJO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
The IUPAC name of 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide (CID 114945924) is 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide.
What is the SMILES notation for 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
The canonical SMILES for 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide is CC1(C)C2OCCC2C1(N)C(=O)NC1CCCNC1=O.
What is the InChIKey of 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
The InChIKey is VTRWKSVPMTXTJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O3/c1-13(2)10-8(5-7-20-10)14(13,15)12(19)17-9-4-3-6-16-11(9)18/h8-10H,3-7,15H2,1-2H3,(H,16,18)(H,17,19).
What are the key properties of 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide?
6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide has a molecular weight of 281.36 g/mol, XLogP of -0.48, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-7,7-dimethyl-N-(2-oxopiperidin-3-yl)-2-oxabicyclo[3.2.0]heptane-6-carboxamide is sourced from PubChem (CID 114945924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).