C20H20FN5O2 — CID 11494661
2-[(2S)-2-(4-aminophenyl)morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one (PubChem CID 11494661) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[(2S)-2-(4-aminophenyl)morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one.
| Compound Name | 2-[(2S)-2-(4-aminophenyl)morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 11494661 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[(2S)-2-(4-aminophenyl)morpholin-4-yl]-6-(3-fluoro-4-pyridinyl)-3-methylpyrimidin-4-one |
| SMILES | Cn1c(N2CCO[C@@H](c3ccc(N)cc3)C2)nc(-c2ccncc2F)cc1=O |
| InChI | InChI=1S/C20H20FN5O2/c1-25-19(27)10-17(15-6-7-23-11-16(15)21)24-20(25)26-8-9-28-18(12-26)13-2-4-14(22)5-3-13/h2-7,10-11,18H,8-9,12,22H2,1H3/t18-/m1/s1 |
| InChIKey | CVARYQGFQNOCPT-GOSISDBHSA-N |
| XLogP | 2.14 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|