About methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate
methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate (PubChem CID 11494693) has the molecular formula C20H15F2N3O3
and a molecular weight of 383.35 g/mol. Its IUPAC name is methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate.
Molecular Properties
| Compound Name | methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate |
| PubChem CID | 11494693 |
| Molecular Formula | C20H15F2N3O3 |
| Molecular Weight | 383.35 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(-c2cnc(NC(=O)c3c(F)cccc3F)cn2)c1 |
| InChI | InChI=1S/C20H15F2N3O3/c1-11-6-7-12(20(27)28-2)8-13(11)16-9-24-17(10-23-16)25-19(26)18-14(21)4-3-5-15(18)22/h3-10H,1-2H3,(H,24,25,26) |
| InChIKey | ICVBQGSFGNUIFB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 383.35 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate?
The IUPAC name of methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate (CID 11494693) is methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate.
What is the SMILES notation for methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate?
The canonical SMILES for methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate is COC(=O)c1ccc(C)c(-c2cnc(NC(=O)c3c(F)cccc3F)cn2)c1.
What is the InChIKey of methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate?
The InChIKey is ICVBQGSFGNUIFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15F2N3O3/c1-11-6-7-12(20(27)28-2)8-13(11)16-9-24-17(10-23-16)25-19(26)18-14(21)4-3-5-15(18)22/h3-10H,1-2H3,(H,24,25,26).
What are the key properties of methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate?
methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate has a molecular weight of 383.35 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[5-[(2,6-difluorobenzoyl)amino]pyrazin-2-yl]-4-methylbenzoate is sourced from PubChem (CID 11494693), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).