C19H18N2O3S2 — CID 11494760
2-N-hydroxy-5-N-[1-[5-(3-methylphenyl)thiophen-2-yl]ethyl]thiophene-2,5-dicarboxamide (PubChem CID 11494760) has the molecular formula C19H18N2O3S2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-N-hydroxy-5-N-[1-[5-(3-methylphenyl)thiophen-2-yl]ethyl]thiophene-2,5-dicarboxamide.
| Compound Name | 2-N-hydroxy-5-N-[1-[5-(3-methylphenyl)thiophen-2-yl]ethyl]thiophene-2,5-dicarboxamide |
|---|---|
| PubChem CID | 11494760 |
| Molecular Formula | C19H18N2O3S2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 2-N-hydroxy-5-N-[1-[5-(3-methylphenyl)thiophen-2-yl]ethyl]thiophene-2,5-dicarboxamide |
| SMILES | Cc1cccc(-c2ccc(C(C)NC(=O)c3ccc(C(=O)NO)s3)s2)c1 |
| InChI | InChI=1S/C19H18N2O3S2/c1-11-4-3-5-13(10-11)15-7-6-14(25-15)12(2)20-18(22)16-8-9-17(26-16)19(23)21-24/h3-10,12,24H,1-2H3,(H,20,22)(H,21,23) |
| InChIKey | DVOCNUXZGXTISK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|