About 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine
8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine (PubChem CID 114947636) has the molecular formula C14H26N2O2S
and a molecular weight of 286.44 g/mol. Its IUPAC name is 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine.
Molecular Properties
| Compound Name | 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
| PubChem CID | 114947636 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine |
| SMILES | CC1(C)C2OCCCC2C1(N)CN1CCS(=O)CC1 |
| InChI | InChI=1S/C14H26N2O2S/c1-13(2)12-11(4-3-7-18-12)14(13,15)10-16-5-8-19(17)9-6-16/h11-12H,3-10,15H2,1-2H3 |
| InChIKey | XXXYXCCFFILWSO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine?
The IUPAC name of 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine (CID 114947636) is 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine.
What is the SMILES notation for 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine?
The canonical SMILES for 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine is CC1(C)C2OCCCC2C1(N)CN1CCS(=O)CC1.
What is the InChIKey of 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine?
The InChIKey is XXXYXCCFFILWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H26N2O2S/c1-13(2)12-11(4-3-7-18-12)14(13,15)10-16-5-8-19(17)9-6-16/h11-12H,3-10,15H2,1-2H3.
What are the key properties of 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine?
8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine has a molecular weight of 286.44 g/mol, XLogP of 0.58, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8,8-dimethyl-7-[(1-oxo-1,4-thiazinan-4-yl)methyl]-2-oxabicyclo[4.2.0]octan-7-amine is sourced from PubChem (CID 114947636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).