About 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol
1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol (PubChem CID 114948261) has the molecular formula C12H23F3N2O
and a molecular weight of 268.32 g/mol. Its IUPAC name is 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol.
Molecular Properties
| Compound Name | 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol |
| PubChem CID | 114948261 |
| Molecular Formula | C12H23F3N2O |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol |
| SMILES | CCC(N)C(N(C)CC1(O)CCCC1)C(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O/c1-3-9(16)10(12(13,14)15)17(2)8-11(18)6-4-5-7-11/h9-10,18H,3-8,16H2,1-2H3 |
| InChIKey | LPQLYPUXKQOWBZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol?
The IUPAC name of 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol (CID 114948261) is 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol.
What is the SMILES notation for 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol?
The canonical SMILES for 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol is CCC(N)C(N(C)CC1(O)CCCC1)C(F)(F)F.
What is the InChIKey of 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol?
The InChIKey is LPQLYPUXKQOWBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N2O/c1-3-9(16)10(12(13,14)15)17(2)8-11(18)6-4-5-7-11/h9-10,18H,3-8,16H2,1-2H3.
What are the key properties of 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol?
1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol has a molecular weight of 268.32 g/mol, XLogP of 1.89, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]cyclopentan-1-ol is sourced from PubChem (CID 114948261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).