C13H24N2O — CID 114948266
7,7-dimethyl-6-[[methyl(prop-2-enyl)amino]methyl]-2-oxabicyclo[3.2.0]heptan-6-amine (PubChem CID 114948266) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is 7,7-dimethyl-6-[[methyl(prop-2-enyl)amino]methyl]-2-oxabicyclo[3.2.0]heptan-6-amine.
| Compound Name | 7,7-dimethyl-6-[[methyl(prop-2-enyl)amino]methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
|---|---|
| PubChem CID | 114948266 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | 7,7-dimethyl-6-[[methyl(prop-2-enyl)amino]methyl]-2-oxabicyclo[3.2.0]heptan-6-amine |
| SMILES | C=CCN(C)CC1(N)C2CCOC2C1(C)C |
| InChI | InChI=1S/C13H24N2O/c1-5-7-15(4)9-13(14)10-6-8-16-11(10)12(13,2)3/h5,10-11H,1,6-9,14H2,2-4H3 |
| InChIKey | RIEUQXDFVPSXHD-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|