About 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol
4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol (PubChem CID 114948493) has the molecular formula C12H23F3N2O2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol |
| PubChem CID | 114948493 |
| Molecular Formula | C12H23F3N2O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol |
| SMILES | CCC(N)C(N(C)CC1(O)CCOCC1)C(F)(F)F |
| InChI | InChI=1S/C12H23F3N2O2/c1-3-9(16)10(12(13,14)15)17(2)8-11(18)4-6-19-7-5-11/h9-10,18H,3-8,16H2,1-2H3 |
| InChIKey | XILUHQHMGQNPRQ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol?
The IUPAC name of 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol (CID 114948493) is 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol is CCC(N)C(N(C)CC1(O)CCOCC1)C(F)(F)F.
What is the InChIKey of 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol?
The InChIKey is XILUHQHMGQNPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23F3N2O2/c1-3-9(16)10(12(13,14)15)17(2)8-11(18)4-6-19-7-5-11/h9-10,18H,3-8,16H2,1-2H3.
What are the key properties of 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol?
4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol has a molecular weight of 284.32 g/mol, XLogP of 1.13, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3-amino-1,1,1-trifluoropentan-2-yl)-methylamino]methyl]oxan-4-ol is sourced from PubChem (CID 114948493), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).