C15H23BrN2O2 — CID 114948515
4-[[[2-amino-1-(3-bromophenyl)ethyl]-methylamino]methyl]oxan-4-ol (PubChem CID 114948515) has the molecular formula C15H23BrN2O2 and a molecular weight of 343.26 g/mol. Its IUPAC name is 4-[[[2-amino-1-(3-bromophenyl)ethyl]-methylamino]methyl]oxan-4-ol.
| Compound Name | 4-[[[2-amino-1-(3-bromophenyl)ethyl]-methylamino]methyl]oxan-4-ol |
|---|---|
| PubChem CID | 114948515 |
| Molecular Formula | C15H23BrN2O2 |
| Molecular Weight | 343.26 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | 4-[[[2-amino-1-(3-bromophenyl)ethyl]-methylamino]methyl]oxan-4-ol |
| SMILES | CN(CC1(O)CCOCC1)C(CN)c1cccc(Br)c1 |
| InChI | InChI=1S/C15H23BrN2O2/c1-18(11-15(19)5-7-20-8-6-15)14(10-17)12-3-2-4-13(16)9-12/h2-4,9,14,19H,5-8,10-11,17H2,1H3 |
| InChIKey | PZPIJOLQSGRZGK-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |