About 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide
2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide (PubChem CID 114948686) has the molecular formula C12H22BrNO2
and a molecular weight of 292.22 g/mol. Its IUPAC name is 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide |
| PubChem CID | 114948686 |
| Molecular Formula | C12H22BrNO2 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.08 |
| IUPAC Name | 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide |
| SMILES | CC(C)C(Br)C(=O)N(C)CC1(O)CCCC1 |
| InChI | InChI=1S/C12H22BrNO2/c1-9(2)10(13)11(15)14(3)8-12(16)6-4-5-7-12/h9-10,16H,4-8H2,1-3H3 |
| InChIKey | KIYRQALKVFEQFW-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide?
The IUPAC name of 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide (CID 114948686) is 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide.
What is the SMILES notation for 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide?
The canonical SMILES for 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide is CC(C)C(Br)C(=O)N(C)CC1(O)CCCC1.
What is the InChIKey of 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide?
The InChIKey is KIYRQALKVFEQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22BrNO2/c1-9(2)10(13)11(15)14(3)8-12(16)6-4-5-7-12/h9-10,16H,4-8H2,1-3H3.
What are the key properties of 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide?
2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide has a molecular weight of 292.22 g/mol, XLogP of 2.17, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[(1-hydroxycyclopentyl)methyl]-N,3-dimethylbutanamide is sourced from PubChem (CID 114948686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).