C18H18ClN3O3S — CID 11494872
(4R,5S)-5-(6-chloro-3-pyridinyl)-N-(2-ethoxyphenyl)-4-methyl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide (PubChem CID 11494872) has the molecular formula C18H18ClN3O3S and a molecular weight of 391.88 g/mol. Its IUPAC name is (4R,5S)-5-(6-chloro-3-pyridinyl)-N-(2-ethoxyphenyl)-4-methyl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide.
| Compound Name | (4R,5S)-5-(6-chloro-3-pyridinyl)-N-(2-ethoxyphenyl)-4-methyl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide |
|---|---|
| PubChem CID | 11494872 |
| Molecular Formula | C18H18ClN3O3S |
| Molecular Weight | 391.88 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | (4R,5S)-5-(6-chloro-3-pyridinyl)-N-(2-ethoxyphenyl)-4-methyl-2-sulfanylidene-1,3-oxazolidine-3-carboxamide |
| SMILES | CCOc1ccccc1NC(=O)N1C(=S)O[C@@H](c2ccc(Cl)nc2)[C@H]1C |
| InChI | InChI=1S/C18H18ClN3O3S/c1-3-24-14-7-5-4-6-13(14)21-17(23)22-11(2)16(25-18(22)26)12-8-9-15(19)20-10-12/h4-11,16H,3H2,1-2H3,(H,21,23)/t11-,16-/m1/s1 |
| InChIKey | FAMKUDBNCYFCRQ-BDJLRTHQSA-N |
| XLogP | 4.41 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.88 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|