C23H28N4O2 — CID 11494881
3-methyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[3,2-d]pyrimidin-4-one (PubChem CID 11494881) has the molecular formula C23H28N4O2 and a molecular weight of 392.50 g/mol. Its IUPAC name is 3-methyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[3,2-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 11494881 |
| Molecular Formula | C23H28N4O2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | 3-methyl-2-[4-[3-[(3S)-3-methylpiperidin-1-yl]propoxy]phenyl]pyrido[3,2-d]pyrimidin-4-one |
| SMILES | C[C@H]1CCCN(CCCOc2ccc(-c3nc4cccnc4c(=O)n3C)cc2)C1 |
| InChI | InChI=1S/C23H28N4O2/c1-17-6-4-13-27(16-17)14-5-15-29-19-10-8-18(9-11-19)22-25-20-7-3-12-24-21(20)23(28)26(22)2/h3,7-12,17H,4-6,13-16H2,1-2H3/t17-/m0/s1 |
| InChIKey | VPWYITSKFZXNBA-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|