C14H17BrN2O2 — CID 114949327
3-bromo-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzonitrile (PubChem CID 114949327) has the molecular formula C14H17BrN2O2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 3-bromo-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzonitrile.
| Compound Name | 3-bromo-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzonitrile |
|---|---|
| PubChem CID | 114949327 |
| Molecular Formula | C14H17BrN2O2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-bromo-4-[(4-hydroxyoxan-4-yl)methyl-methylamino]benzonitrile |
| SMILES | CN(CC1(O)CCOCC1)c1ccc(C#N)cc1Br |
| InChI | InChI=1S/C14H17BrN2O2/c1-17(10-14(18)4-6-19-7-5-14)13-3-2-11(9-16)8-12(13)15/h2-3,8,18H,4-7,10H2,1H3 |
| InChIKey | UBPDUVCTOBZHPH-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |