C14H17BrFNO3 — CID 114949575
5-bromo-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide (PubChem CID 114949575) has the molecular formula C14H17BrFNO3 and a molecular weight of 346.20 g/mol. Its IUPAC name is 5-bromo-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide.
| Compound Name | 5-bromo-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 114949575 |
| Molecular Formula | C14H17BrFNO3 |
| Molecular Weight | 346.20 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | 5-bromo-2-fluoro-N-[(4-hydroxyoxan-4-yl)methyl]-N-methylbenzamide |
| SMILES | CN(CC1(O)CCOCC1)C(=O)c1cc(Br)ccc1F |
| InChI | InChI=1S/C14H17BrFNO3/c1-17(9-14(19)4-6-20-7-5-14)13(18)11-8-10(15)2-3-12(11)16/h2-3,8,19H,4-7,9H2,1H3 |
| InChIKey | HTGJUAYSMVFIPX-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.20 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |