C14H20ClN3O2 — CID 114949633
4-chloro-N'-hydroxy-2-[(1-hydroxycyclopentyl)methyl-methylamino]benzenecarboximidamide (PubChem CID 114949633) has the molecular formula C14H20ClN3O2 and a molecular weight of 297.79 g/mol. Its IUPAC name is 4-chloro-N'-hydroxy-2-[(1-hydroxycyclopentyl)methyl-methylamino]benzenecarboximidamide.
| Compound Name | 4-chloro-N'-hydroxy-2-[(1-hydroxycyclopentyl)methyl-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 114949633 |
| Molecular Formula | C14H20ClN3O2 |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 4-chloro-N'-hydroxy-2-[(1-hydroxycyclopentyl)methyl-methylamino]benzenecarboximidamide |
| SMILES | CN(CC1(O)CCCC1)c1cc(Cl)ccc1/C(N)=N/O |
| InChI | InChI=1S/C14H20ClN3O2/c1-18(9-14(19)6-2-3-7-14)12-8-10(15)4-5-11(12)13(16)17-20/h4-5,8,19-20H,2-3,6-7,9H2,1H3,(H2,16,17) |
| InChIKey | VFUDMBYTOXBFDQ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 82.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|