C11H23N3O — CID 114949784
4-[(1-hydroxycyclopentyl)methyl-methylamino]butanimidamide (PubChem CID 114949784) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is 4-[(1-hydroxycyclopentyl)methyl-methylamino]butanimidamide.
| Compound Name | 4-[(1-hydroxycyclopentyl)methyl-methylamino]butanimidamide |
|---|---|
| PubChem CID | 114949784 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 4-[(1-hydroxycyclopentyl)methyl-methylamino]butanimidamide |
| SMILES | [H]/N=C(\N)CCCN(C)CC1(O)CCCC1 |
| InChI | InChI=1S/C11H23N3O/c1-14(8-4-5-10(12)13)9-11(15)6-2-3-7-11/h15H,2-9H2,1H3,(H3,12,13) |
| InChIKey | SDVOMPOKHSAXTE-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 73.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|