About (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one
(3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one (PubChem CID 11494998) has the molecular formula C25H21NO4
and a molecular weight of 399.45 g/mol. Its IUPAC name is (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one.
Molecular Properties
| Compound Name | (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one |
| PubChem CID | 11494998 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one |
| SMILES | O=C1O[C@]2(CCN(C(=O)c3ccc(OCc4ccccc4)cc3)C2)c2ccccc21 |
| InChI | InChI=1S/C25H21NO4/c27-23(19-10-12-20(13-11-19)29-16-18-6-2-1-3-7-18)26-15-14-25(17-26)22-9-5-4-8-21(22)24(28)30-25/h1-13H,14-17H2/t25-/m0/s1 |
| InChIKey | HOQLIGKSPOESCO-VWLOTQADSA-N |
| XLogP | 4.18 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one?
The IUPAC name of (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one (CID 11494998) is (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one.
What is the SMILES notation for (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one?
The canonical SMILES for (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one is O=C1O[C@]2(CCN(C(=O)c3ccc(OCc4ccccc4)cc3)C2)c2ccccc21.
What is the InChIKey of (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one?
The InChIKey is HOQLIGKSPOESCO-VWLOTQADSA-N. The full InChI is InChI=1S/C25H21NO4/c27-23(19-10-12-20(13-11-19)29-16-18-6-2-1-3-7-18)26-15-14-25(17-26)22-9-5-4-8-21(22)24(28)30-25/h1-13H,14-17H2/t25-/m0/s1.
What are the key properties of (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one?
(3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one has a molecular weight of 399.45 g/mol, XLogP of 4.18, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1'-(4-phenylmethoxybenzoyl)spiro[2-benzofuran-3,3'-pyrrolidine]-1-one is sourced from PubChem (CID 11494998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).