C11H4F9NO3S — CID 11495034
(2-cyanophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 11495034) has the molecular formula C11H4F9NO3S and a molecular weight of 401.21 g/mol. Its IUPAC name is (2-cyanophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | (2-cyanophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 11495034 |
| Molecular Formula | C11H4F9NO3S |
| Molecular Weight | 401.21 g/mol |
| Exact Mass | 400.98 |
| IUPAC Name | (2-cyanophenyl) 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | N#Cc1ccccc1OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H4F9NO3S/c12-8(13,10(16,17)18)9(14,15)11(19,20)25(22,23)24-7-4-2-1-3-6(7)5-21/h1-4H |
| InChIKey | QYJKOHQHCLZHIT-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.21 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|