C23H44O4Si — CID 11495287
(3S,4R)-4-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyloxetan-2-one (PubChem CID 11495287) has the molecular formula C23H44O4Si and a molecular weight of 412.69 g/mol. Its IUPAC name is (3S,4R)-4-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyloxetan-2-one.
| Compound Name | (3S,4R)-4-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyloxetan-2-one |
|---|---|
| PubChem CID | 11495287 |
| Molecular Formula | C23H44O4Si |
| Molecular Weight | 412.69 g/mol |
| Exact Mass | 412.30 |
| IUPAC Name | (3S,4R)-4-[(E,2R,3R,4R,5S)-2-[tert-butyl(dimethyl)silyl]oxy-4-methoxy-3,5-dimethylnon-7-enyl]-3-ethyloxetan-2-one |
| SMILES | C/C=C/C[C@H](C)[C@@H](OC)[C@@H](C)[C@@H](C[C@H]1OC(=O)[C@H]1CC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H44O4Si/c1-11-13-14-16(3)21(25-8)17(4)19(27-28(9,10)23(5,6)7)15-20-18(12-2)22(24)26-20/h11,13,16-21H,12,14-15H2,1-10H3/b13-11+/t16-,17-,18-,19+,20+,21+/m0/s1 |
| InChIKey | DZPNYVJBAOMUFY-DAYTYXCJSA-N |
| XLogP | 5.97 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.69 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|