About 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol
4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol (PubChem CID 114953606) has the molecular formula C16H34N2O2
and a molecular weight of 286.46 g/mol. Its IUPAC name is 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol.
Molecular Properties
| Compound Name | 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol |
| PubChem CID | 114953606 |
| Molecular Formula | C16H34N2O2 |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.26 |
| IUPAC Name | 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol |
| SMILES | CC(C)CNCC(C)(C)CN(C)CC1(O)CCOCC1 |
| InChI | InChI=1S/C16H34N2O2/c1-14(2)10-17-11-15(3,4)12-18(5)13-16(19)6-8-20-9-7-16/h14,17,19H,6-13H2,1-5H3 |
| InChIKey | ZPHGUJDMNKMDGE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol?
The IUPAC name of 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol (CID 114953606) is 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol.
What is the SMILES notation for 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol?
The canonical SMILES for 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol is CC(C)CNCC(C)(C)CN(C)CC1(O)CCOCC1.
What is the InChIKey of 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol?
The InChIKey is ZPHGUJDMNKMDGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34N2O2/c1-14(2)10-17-11-15(3,4)12-18(5)13-16(19)6-8-20-9-7-16/h14,17,19H,6-13H2,1-5H3.
What are the key properties of 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol?
4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol has a molecular weight of 286.46 g/mol, XLogP of 1.73, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[[2,2-dimethyl-3-(2-methylpropylamino)propyl]-methylamino]methyl]oxan-4-ol is sourced from PubChem (CID 114953606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).