About phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate
phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate (PubChem CID 11495362) has the molecular formula C24H20N2O5
and a molecular weight of 416.43 g/mol. Its IUPAC name is phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate.
Molecular Properties
| Compound Name | phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate |
| PubChem CID | 11495362 |
| Molecular Formula | C24H20N2O5 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate |
| SMILES | COc1cc2nccc(Oc3ccc(NC(=O)Oc4ccccc4)cc3)c2cc1OC |
| InChI | InChI=1S/C24H20N2O5/c1-28-22-14-19-20(15-23(22)29-2)25-13-12-21(19)30-18-10-8-16(9-11-18)26-24(27)31-17-6-4-3-5-7-17/h3-15H,1-2H3,(H,26,27) |
| InChIKey | KVDZJYLUBBYJIX-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate?
The IUPAC name of phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate (CID 11495362) is phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate.
What is the SMILES notation for phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate?
The canonical SMILES for phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate is COc1cc2nccc(Oc3ccc(NC(=O)Oc4ccccc4)cc3)c2cc1OC.
What is the InChIKey of phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate?
The InChIKey is KVDZJYLUBBYJIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O5/c1-28-22-14-19-20(15-23(22)29-2)25-13-12-21(19)30-18-10-8-16(9-11-18)26-24(27)31-17-6-4-3-5-7-17/h3-15H,1-2H3,(H,26,27).
What are the key properties of phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate?
phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate has a molecular weight of 416.43 g/mol, XLogP of 5.66, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl N-[4-(6,7-dimethoxyquinolin-4-yl)oxyphenyl]carbamate is sourced from PubChem (CID 11495362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).