About (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one
(4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one (PubChem CID 11495484) has the molecular formula C25H31NO3Si
and a molecular weight of 421.61 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 11495484 |
| Molecular Formula | C25H31NO3Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one |
| SMILES | C[Si](C)(C)C/C=C/[C@@H](Cc1ccccc1)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C25H31NO3Si/c1-30(2,3)16-10-15-22(17-20-11-6-4-7-12-20)24(27)26-23(19-29-25(26)28)18-21-13-8-5-9-14-21/h4-15,22-23H,16-19H2,1-3H3/b15-10+/t22-,23+/m0/s1 |
| InChIKey | KSRUGOKADREQBA-UKRIWCLYSA-N |
| XLogP | 5.33 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one?
The IUPAC name of (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one (CID 11495484) is (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one is C[Si](C)(C)C/C=C/[C@@H](Cc1ccccc1)C(=O)N1C(=O)OC[C@H]1Cc1ccccc1.
What is the InChIKey of (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one?
The InChIKey is KSRUGOKADREQBA-UKRIWCLYSA-N. The full InChI is InChI=1S/C25H31NO3Si/c1-30(2,3)16-10-15-22(17-20-11-6-4-7-12-20)24(27)26-23(19-29-25(26)28)18-21-13-8-5-9-14-21/h4-15,22-23H,16-19H2,1-3H3/b15-10+/t22-,23+/m0/s1.
What are the key properties of (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one?
(4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one has a molecular weight of 421.61 g/mol, XLogP of 5.33, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-benzyl-3-[(E,2R)-2-benzyl-5-trimethylsilylpent-3-enoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 11495484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).