About 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol
1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol (PubChem CID 114955019) has the molecular formula C18H22N2O
and a molecular weight of 282.39 g/mol. Its IUPAC name is 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol.
Molecular Properties
| Compound Name | 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol |
| PubChem CID | 114955019 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol |
| SMILES | Cc1ccncc1CNC1CC(C)c2c(C)ccc(O)c21 |
| InChI | InChI=1S/C18H22N2O/c1-11-6-7-19-9-14(11)10-20-15-8-13(3)17-12(2)4-5-16(21)18(15)17/h4-7,9,13,15,20-21H,8,10H2,1-3H3 |
| InChIKey | LMZIZPVEBDBAOY-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol?
The IUPAC name of 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol (CID 114955019) is 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol.
What is the SMILES notation for 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol?
The canonical SMILES for 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol is Cc1ccncc1CNC1CC(C)c2c(C)ccc(O)c21.
What is the InChIKey of 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol?
The InChIKey is LMZIZPVEBDBAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O/c1-11-6-7-19-9-14(11)10-20-15-8-13(3)17-12(2)4-5-16(21)18(15)17/h4-7,9,13,15,20-21H,8,10H2,1-3H3.
What are the key properties of 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol?
1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol has a molecular weight of 282.39 g/mol, XLogP of 3.74, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7-dimethyl-3-[(4-methyl-3-pyridinyl)methylamino]-2,3-dihydro-1H-inden-4-ol is sourced from PubChem (CID 114955019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).