C16H19FN2O2 — CID 114955427
1-(4-fluorophenoxy)-3-[(4-methyl-3-pyridinyl)methylamino]propan-2-ol (PubChem CID 114955427) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 1-(4-fluorophenoxy)-3-[(4-methyl-3-pyridinyl)methylamino]propan-2-ol.
| Compound Name | 1-(4-fluorophenoxy)-3-[(4-methyl-3-pyridinyl)methylamino]propan-2-ol |
|---|---|
| PubChem CID | 114955427 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 1-(4-fluorophenoxy)-3-[(4-methyl-3-pyridinyl)methylamino]propan-2-ol |
| SMILES | Cc1ccncc1CNCC(O)COc1ccc(F)cc1 |
| InChI | InChI=1S/C16H19FN2O2/c1-12-6-7-18-8-13(12)9-19-10-15(20)11-21-16-4-2-14(17)3-5-16/h2-8,15,19-20H,9-11H2,1H3 |
| InChIKey | MQMASGMBQKKXDF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |