C10H13N3 — CID 114955540
2-[(4-methyl-3-pyridinyl)methylamino]propanenitrile (PubChem CID 114955540) has the molecular formula C10H13N3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2-[(4-methyl-3-pyridinyl)methylamino]propanenitrile.
| Compound Name | 2-[(4-methyl-3-pyridinyl)methylamino]propanenitrile |
|---|---|
| PubChem CID | 114955540 |
| Molecular Formula | C10H13N3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.11 |
| IUPAC Name | 2-[(4-methyl-3-pyridinyl)methylamino]propanenitrile |
| SMILES | Cc1ccncc1CNC(C)C#N |
| InChI | InChI=1S/C10H13N3/c1-8-3-4-12-6-10(8)7-13-9(2)5-11/h3-4,6,9,13H,7H2,1-2H3 |
| InChIKey | OHOFONGUNREBDA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |