C15H25F3N2O — CID 114955797
N-[(4-methylpiperidin-3-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 114955797) has the molecular formula C15H25F3N2O and a molecular weight of 306.37 g/mol. Its IUPAC name is N-[(4-methylpiperidin-3-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide.
| Compound Name | N-[(4-methylpiperidin-3-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 114955797 |
| Molecular Formula | C15H25F3N2O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-[(4-methylpiperidin-3-yl)methyl]-2-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC1CCNCC1CNC(=O)C1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C15H25F3N2O/c1-10-6-7-19-8-11(10)9-20-14(21)12-4-2-3-5-13(12)15(16,17)18/h10-13,19H,2-9H2,1H3,(H,20,21) |
| InChIKey | FUYBKZYTNDCBKT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |