C18H24ClN7O — CID 11495588
3,5-diamino-6-chloro-N-[N'-(6-phenylhexyl)carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11495588) has the molecular formula C18H24ClN7O and a molecular weight of 389.89 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-(6-phenylhexyl)carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-(6-phenylhexyl)carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11495588 |
| Molecular Formula | C18H24ClN7O |
| Molecular Weight | 389.89 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-(6-phenylhexyl)carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCCCc1ccccc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C18H24ClN7O/c19-14-16(21)25-15(20)13(24-14)17(27)26-18(22)23-11-7-2-1-4-8-12-9-5-3-6-10-12/h3,5-6,9-10H,1-2,4,7-8,11H2,(H4,20,21,25)(H3,22,23,26,27) |
| InChIKey | HXLRWHNZECIEOM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.89 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|