About 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol
2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol (PubChem CID 11495632) has the molecular formula C24H26ClNO2S
and a molecular weight of 428.00 g/mol. Its IUPAC name is 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol |
| PubChem CID | 11495632 |
| Molecular Formula | C24H26ClNO2S |
| Molecular Weight | 428.00 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol |
| SMILES | NC(CO)(CO)CCCc1ccc(Sc2ccc(-c3ccccc3)cc2)cc1Cl |
| InChI | InChI=1S/C24H26ClNO2S/c25-23-15-22(13-10-20(23)7-4-14-24(26,16-27)17-28)29-21-11-8-19(9-12-21)18-5-2-1-3-6-18/h1-3,5-6,8-13,15,27-28H,4,7,14,16-17,26H2 |
| InChIKey | YCLNWJIBANZAAD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.00 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol?
The IUPAC name of 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol (CID 11495632) is 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol.
What is the SMILES notation for 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol?
The canonical SMILES for 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol is NC(CO)(CO)CCCc1ccc(Sc2ccc(-c3ccccc3)cc2)cc1Cl.
What is the InChIKey of 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol?
The InChIKey is YCLNWJIBANZAAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26ClNO2S/c25-23-15-22(13-10-20(23)7-4-14-24(26,16-27)17-28)29-21-11-8-19(9-12-21)18-5-2-1-3-6-18/h1-3,5-6,8-13,15,27-28H,4,7,14,16-17,26H2.
What are the key properties of 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol?
2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol has a molecular weight of 428.00 g/mol, XLogP of 5.16, 9 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[3-[2-chloro-4-(4-phenylphenyl)sulfanylphenyl]propyl]propane-1,3-diol is sourced from PubChem (CID 11495632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).