C15H16N2O2 — CID 114956373
2-hydroxy-3-methyl-N-[(4-methyl-3-pyridinyl)methyl]benzamide (PubChem CID 114956373) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-hydroxy-3-methyl-N-[(4-methyl-3-pyridinyl)methyl]benzamide.
| Compound Name | 2-hydroxy-3-methyl-N-[(4-methyl-3-pyridinyl)methyl]benzamide |
|---|---|
| PubChem CID | 114956373 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 2-hydroxy-3-methyl-N-[(4-methyl-3-pyridinyl)methyl]benzamide |
| SMILES | Cc1ccncc1CNC(=O)c1cccc(C)c1O |
| InChI | InChI=1S/C15H16N2O2/c1-10-6-7-16-8-12(10)9-17-15(19)13-5-3-4-11(2)14(13)18/h3-8,18H,9H2,1-2H3,(H,17,19) |
| InChIKey | CFDZHOLEXSWBAP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |